C22H29ClN3O3- — CID 22039102
2-(4-carbamimidoylanilino)-2-(2-methyl-5-propan-2-yl-4-propan-2-yloxyphenyl)acetate;hydrochloride (PubChem CID 22039102) has the molecular formula C22H29ClN3O3- and a molecular weight of 418.95 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-(2-methyl-5-propan-2-yl-4-propan-2-yloxyphenyl)acetate;hydrochloride.
| Compound Name | 2-(4-carbamimidoylanilino)-2-(2-methyl-5-propan-2-yl-4-propan-2-yloxyphenyl)acetate;hydrochloride |
|---|---|
| PubChem CID | 22039102 |
| Molecular Formula | C22H29ClN3O3- |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-(2-methyl-5-propan-2-yl-4-propan-2-yloxyphenyl)acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NC(C(=O)[O-])c2cc(C(C)C)c(OC(C)C)cc2C)cc1 |
| InChI | InChI=1S/C22H29N3O3.ClH/c1-12(2)17-11-18(14(5)10-19(17)28-13(3)4)20(22(26)27)25-16-8-6-15(7-9-16)21(23)24;/h6-13,20,25H,1-5H3,(H3,23,24)(H,26,27);1H/p-1 |
| InChIKey | KIDRDMCSAYXLFT-UHFFFAOYSA-M |
| XLogP | 3.51 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|