C23H30N4O4 — CID 174413339
[2-[4-(2-amino-2-oxoethoxy)-2-methyl-5-propan-2-ylphenyl]-2-(4-carbamimidoylanilino)ethyl] acetate (PubChem CID 174413339) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is [2-[4-(2-amino-2-oxoethoxy)-2-methyl-5-propan-2-ylphenyl]-2-(4-carbamimidoylanilino)ethyl] acetate.
| Compound Name | [2-[4-(2-amino-2-oxoethoxy)-2-methyl-5-propan-2-ylphenyl]-2-(4-carbamimidoylanilino)ethyl] acetate |
|---|---|
| PubChem CID | 174413339 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | [2-[4-(2-amino-2-oxoethoxy)-2-methyl-5-propan-2-ylphenyl]-2-(4-carbamimidoylanilino)ethyl] acetate |
| SMILES | [H]/N=C(\N)c1ccc(NC(COC(C)=O)c2cc(C(C)C)c(OCC(N)=O)cc2C)cc1 |
| InChI | InChI=1S/C23H30N4O4/c1-13(2)18-10-19(14(3)9-21(18)31-12-22(24)29)20(11-30-15(4)28)27-17-7-5-16(6-8-17)23(25)26/h5-10,13,20,27H,11-12H2,1-4H3,(H2,24,29)(H3,25,26) |
| InChIKey | MPWYJJQJPYZRBQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 140.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|