C25H28N4O4S — CID 174397493
[2-[3-(benzenesulfonamido)-5-ethylphenyl]-2-(4-carbamimidoylanilino)ethyl] acetate (PubChem CID 174397493) has the molecular formula C25H28N4O4S and a molecular weight of 480.59 g/mol. Its IUPAC name is [2-[3-(benzenesulfonamido)-5-ethylphenyl]-2-(4-carbamimidoylanilino)ethyl] acetate.
| Compound Name | [2-[3-(benzenesulfonamido)-5-ethylphenyl]-2-(4-carbamimidoylanilino)ethyl] acetate |
|---|---|
| PubChem CID | 174397493 |
| Molecular Formula | C25H28N4O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | [2-[3-(benzenesulfonamido)-5-ethylphenyl]-2-(4-carbamimidoylanilino)ethyl] acetate |
| SMILES | [H]/N=C(\N)c1ccc(NC(COC(C)=O)c2cc(CC)cc(NS(=O)(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H28N4O4S/c1-3-18-13-20(15-22(14-18)29-34(31,32)23-7-5-4-6-8-23)24(16-33-17(2)30)28-21-11-9-19(10-12-21)25(26)27/h4-15,24,28-29H,3,16H2,1-2H3,(H3,26,27) |
| InChIKey | SNNDRDCITUMDHP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|