C27H28F3N3O6S — CID 21217932
methyl 5-[4-(benzenesulfonamido)phenyl]-3-(3-carbamimidoylphenyl)pentanoate;2,2,2-trifluoroacetic acid (PubChem CID 21217932) has the molecular formula C27H28F3N3O6S and a molecular weight of 579.60 g/mol. Its IUPAC name is methyl 5-[4-(benzenesulfonamido)phenyl]-3-(3-carbamimidoylphenyl)pentanoate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 5-[4-(benzenesulfonamido)phenyl]-3-(3-carbamimidoylphenyl)pentanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 21217932 |
| Molecular Formula | C27H28F3N3O6S |
| Molecular Weight | 579.60 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | methyl 5-[4-(benzenesulfonamido)phenyl]-3-(3-carbamimidoylphenyl)pentanoate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cccc(C(CCc2ccc(NS(=O)(=O)c3ccccc3)cc2)CC(=O)OC)c1 |
| InChI | InChI=1S/C25H27N3O4S.C2HF3O2/c1-32-24(29)17-20(19-6-5-7-21(16-19)25(26)27)13-10-18-11-14-22(15-12-18)28-33(30,31)23-8-3-2-4-9-23;3-2(4,5)1(6)7/h2-9,11-12,14-16,20,28H,10,13,17H2,1H3,(H3,26,27);(H,6,7) |
| InChIKey | MTZLKTWMEJPNOU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 159.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|