C20H21F3N4O7S — CID 71477830
4-[4-[(3-carbamimidoylphenyl)sulfonylamino]butanoylamino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 71477830) has the molecular formula C20H21F3N4O7S and a molecular weight of 518.47 g/mol. Its IUPAC name is 4-[4-[(3-carbamimidoylphenyl)sulfonylamino]butanoylamino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[4-[(3-carbamimidoylphenyl)sulfonylamino]butanoylamino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71477830 |
| Molecular Formula | C20H21F3N4O7S |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | 4-[4-[(3-carbamimidoylphenyl)sulfonylamino]butanoylamino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cccc(S(=O)(=O)NCCCC(=O)Nc2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C18H20N4O5S.C2HF3O2/c19-17(20)13-3-1-4-15(11-13)28(26,27)21-10-2-5-16(23)22-14-8-6-12(7-9-14)18(24)25;3-2(4,5)1(6)7/h1,3-4,6-9,11,21H,2,5,10H2,(H3,19,20)(H,22,23)(H,24,25);(H,6,7) |
| InChIKey | KOAACDTUGNMLOV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 199.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|