C20H27ClN4O5S — CID 71462164
4-[(3-carbamimidoylphenyl)sulfonylamino]-N-[(3,4-dimethoxyphenyl)methyl]butanamide;hydrochloride (PubChem CID 71462164) has the molecular formula C20H27ClN4O5S and a molecular weight of 470.98 g/mol. Its IUPAC name is 4-[(3-carbamimidoylphenyl)sulfonylamino]-N-[(3,4-dimethoxyphenyl)methyl]butanamide;hydrochloride.
| Compound Name | 4-[(3-carbamimidoylphenyl)sulfonylamino]-N-[(3,4-dimethoxyphenyl)methyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 71462164 |
| Molecular Formula | C20H27ClN4O5S |
| Molecular Weight | 470.98 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 4-[(3-carbamimidoylphenyl)sulfonylamino]-N-[(3,4-dimethoxyphenyl)methyl]butanamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1cccc(S(=O)(=O)NCCCC(=O)NCc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C20H26N4O5S.ClH/c1-28-17-9-8-14(11-18(17)29-2)13-23-19(25)7-4-10-24-30(26,27)16-6-3-5-15(12-16)20(21)22;/h3,5-6,8-9,11-12,24H,4,7,10,13H2,1-2H3,(H3,21,22)(H,23,25);1H |
| InChIKey | GTTLYSFEDYMTPD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 143.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.98 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|