C20H26N2O4S — CID 9246232
4-[(3,4-dimethylphenyl)sulfonylamino]-N-[(2-methoxyphenyl)methyl]butanamide (PubChem CID 9246232) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is 4-[(3,4-dimethylphenyl)sulfonylamino]-N-[(2-methoxyphenyl)methyl]butanamide.
| Compound Name | 4-[(3,4-dimethylphenyl)sulfonylamino]-N-[(2-methoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 9246232 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 4-[(3,4-dimethylphenyl)sulfonylamino]-N-[(2-methoxyphenyl)methyl]butanamide |
| SMILES | COc1ccccc1CNC(=O)CCCNS(=O)(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C20H26N2O4S/c1-15-10-11-18(13-16(15)2)27(24,25)22-12-6-9-20(23)21-14-17-7-4-5-8-19(17)26-3/h4-5,7-8,10-11,13,22H,6,9,12,14H2,1-3H3,(H,21,23) |
| InChIKey | OTFFMGHRMXNSQI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|