C19H25NO5S — CID 110409185
3,4-dimethoxy-N-[4-(2-methoxyphenyl)butyl]benzenesulfonamide (PubChem CID 110409185) has the molecular formula C19H25NO5S and a molecular weight of 379.48 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[4-(2-methoxyphenyl)butyl]benzenesulfonamide.
| Compound Name | 3,4-dimethoxy-N-[4-(2-methoxyphenyl)butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110409185 |
| Molecular Formula | C19H25NO5S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 3,4-dimethoxy-N-[4-(2-methoxyphenyl)butyl]benzenesulfonamide |
| SMILES | COc1ccccc1CCCCNS(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H25NO5S/c1-23-17-10-5-4-8-15(17)9-6-7-13-20-26(21,22)16-11-12-18(24-2)19(14-16)25-3/h4-5,8,10-12,14,20H,6-7,9,13H2,1-3H3 |
| InChIKey | XMBKHSPAWIJQEA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|