C18H22FNO4S — CID 110601561
N-[4-(2-fluorophenyl)butyl]-3,4-dimethoxybenzenesulfonamide (PubChem CID 110601561) has the molecular formula C18H22FNO4S and a molecular weight of 367.44 g/mol. Its IUPAC name is N-[4-(2-fluorophenyl)butyl]-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[4-(2-fluorophenyl)butyl]-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 110601561 |
| Molecular Formula | C18H22FNO4S |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | N-[4-(2-fluorophenyl)butyl]-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCCCc2ccccc2F)cc1OC |
| InChI | InChI=1S/C18H22FNO4S/c1-23-17-11-10-15(13-18(17)24-2)25(21,22)20-12-6-5-8-14-7-3-4-9-16(14)19/h3-4,7,9-11,13,20H,5-6,8,12H2,1-2H3 |
| InChIKey | XOAWNYWUHKTYDR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|