C15H27N2O4S+ — CID 9263864
3-[(3,4-dimethoxyphenyl)sulfonylamino]propyl-diethylazanium (PubChem CID 9263864) has the molecular formula C15H27N2O4S+ and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)sulfonylamino]propyl-diethylazanium.
| Compound Name | 3-[(3,4-dimethoxyphenyl)sulfonylamino]propyl-diethylazanium |
|---|---|
| PubChem CID | 9263864 |
| Molecular Formula | C15H27N2O4S+ |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)sulfonylamino]propyl-diethylazanium |
| SMILES | CC[NH+](CC)CCCNS(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H26N2O4S/c1-5-17(6-2)11-7-10-16-22(18,19)13-8-9-14(20-3)15(12-13)21-4/h8-9,12,16H,5-7,10-11H2,1-4H3/p+1 |
| InChIKey | RXEQCUSXNYHUAV-UHFFFAOYSA-O |
| XLogP | 0.30 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|