C12H19NO4S2 — CID 3376302
N-(2-ethylsulfanylethyl)-3,4-dimethoxybenzenesulfonamide (PubChem CID 3376302) has the molecular formula C12H19NO4S2 and a molecular weight of 305.42 g/mol. Its IUPAC name is N-(2-ethylsulfanylethyl)-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-(2-ethylsulfanylethyl)-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 3376302 |
| Molecular Formula | C12H19NO4S2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N-(2-ethylsulfanylethyl)-3,4-dimethoxybenzenesulfonamide |
| SMILES | CCSCCNS(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C12H19NO4S2/c1-4-18-8-7-13-19(14,15)10-5-6-11(16-2)12(9-10)17-3/h5-6,9,13H,4,7-8H2,1-3H3 |
| InChIKey | DHOBKEUOVJGEPV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|