C14H25N2O3S+ — CID 8511849
diethyl-[2-[(2-methoxy-5-methylphenyl)sulfonylamino]ethyl]azanium (PubChem CID 8511849) has the molecular formula C14H25N2O3S+ and a molecular weight of 301.43 g/mol. Its IUPAC name is diethyl-[2-[(2-methoxy-5-methylphenyl)sulfonylamino]ethyl]azanium.
| Compound Name | diethyl-[2-[(2-methoxy-5-methylphenyl)sulfonylamino]ethyl]azanium |
|---|---|
| PubChem CID | 8511849 |
| Molecular Formula | C14H25N2O3S+ |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | diethyl-[2-[(2-methoxy-5-methylphenyl)sulfonylamino]ethyl]azanium |
| SMILES | CC[NH+](CC)CCNS(=O)(=O)c1cc(C)ccc1OC |
| InChI | InChI=1S/C14H24N2O3S/c1-5-16(6-2)10-9-15-20(17,18)14-11-12(3)7-8-13(14)19-4/h7-8,11,15H,5-6,9-10H2,1-4H3/p+1 |
| InChIKey | HTQRJRVJQSWRRR-UHFFFAOYSA-O |
| XLogP | 0.21 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |