C27H33ClN4O6 — CID 70004631
(2R)-2-(4-carbamimidoylanilino)-N-[(3,4-dimethoxyphenyl)methyl]-2-(3,4,5-trimethoxyphenyl)acetamide;hydrochloride (PubChem CID 70004631) has the molecular formula C27H33ClN4O6 and a molecular weight of 545.04 g/mol. Its IUPAC name is (2R)-2-(4-carbamimidoylanilino)-N-[(3,4-dimethoxyphenyl)methyl]-2-(3,4,5-trimethoxyphenyl)acetamide;hydrochloride.
| Compound Name | (2R)-2-(4-carbamimidoylanilino)-N-[(3,4-dimethoxyphenyl)methyl]-2-(3,4,5-trimethoxyphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 70004631 |
| Molecular Formula | C27H33ClN4O6 |
| Molecular Weight | 545.04 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | (2R)-2-(4-carbamimidoylanilino)-N-[(3,4-dimethoxyphenyl)methyl]-2-(3,4,5-trimethoxyphenyl)acetamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(N[C@@H](C(=O)NCc2ccc(OC)c(OC)c2)c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C27H32N4O6.ClH/c1-33-20-11-6-16(12-21(20)34-2)15-30-27(32)24(31-19-9-7-17(8-10-19)26(28)29)18-13-22(35-3)25(37-5)23(14-18)36-4;/h6-14,24,31H,15H2,1-5H3,(H3,28,29)(H,30,32);1H/t24-;/m1./s1 |
| InChIKey | SRLXGMGLHSTNAU-GJFSDDNBSA-N |
| XLogP | 3.91 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.04 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|