C30H31ClN4O3 — CID 23283307
N-benzyl-2-(4-carbamimidoylanilino)-2-(3-methoxy-5-phenylmethoxyphenyl)acetamide;hydrochloride (PubChem CID 23283307) has the molecular formula C30H31ClN4O3 and a molecular weight of 531.06 g/mol. Its IUPAC name is N-benzyl-2-(4-carbamimidoylanilino)-2-(3-methoxy-5-phenylmethoxyphenyl)acetamide;hydrochloride.
| Compound Name | N-benzyl-2-(4-carbamimidoylanilino)-2-(3-methoxy-5-phenylmethoxyphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 23283307 |
| Molecular Formula | C30H31ClN4O3 |
| Molecular Weight | 531.06 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | N-benzyl-2-(4-carbamimidoylanilino)-2-(3-methoxy-5-phenylmethoxyphenyl)acetamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NC(C(=O)NCc2ccccc2)c2cc(OC)cc(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C30H30N4O3.ClH/c1-36-26-16-24(17-27(18-26)37-20-22-10-6-3-7-11-22)28(30(35)33-19-21-8-4-2-5-9-21)34-25-14-12-23(13-15-25)29(31)32;/h2-18,28,34H,19-20H2,1H3,(H3,31,32)(H,33,35);1H |
| InChIKey | SGIHMQYHRJFRTC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 109.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.06 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|