C25H29ClN4O4 — CID 23283614
N-benzyl-2-(4-carbamimidoylanilino)-2-(3,4,5-trimethoxyphenyl)acetamide;hydrochloride (PubChem CID 23283614) has the molecular formula C25H29ClN4O4 and a molecular weight of 484.98 g/mol. Its IUPAC name is N-benzyl-2-(4-carbamimidoylanilino)-2-(3,4,5-trimethoxyphenyl)acetamide;hydrochloride.
| Compound Name | N-benzyl-2-(4-carbamimidoylanilino)-2-(3,4,5-trimethoxyphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 23283614 |
| Molecular Formula | C25H29ClN4O4 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | N-benzyl-2-(4-carbamimidoylanilino)-2-(3,4,5-trimethoxyphenyl)acetamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NC(C(=O)NCc2ccccc2)c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C25H28N4O4.ClH/c1-31-20-13-18(14-21(32-2)23(20)33-3)22(25(30)28-15-16-7-5-4-6-8-16)29-19-11-9-17(10-12-19)24(26)27;/h4-14,22,29H,15H2,1-3H3,(H3,26,27)(H,28,30);1H |
| InChIKey | CDOGHAPOCVDGDZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|