C29H35N5O4 — CID 70003659
(2R)-N-benzyl-2-(4-carbamimidoylanilino)-2-[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]acetamide (PubChem CID 70003659) has the molecular formula C29H35N5O4 and a molecular weight of 517.63 g/mol. Its IUPAC name is (2R)-N-benzyl-2-(4-carbamimidoylanilino)-2-[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]acetamide.
| Compound Name | (2R)-N-benzyl-2-(4-carbamimidoylanilino)-2-[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 70003659 |
| Molecular Formula | C29H35N5O4 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | (2R)-N-benzyl-2-(4-carbamimidoylanilino)-2-[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(N[C@@H](C(=O)NCc2ccccc2)c2ccc(OCCN3CCOCC3)c(OC)c2)cc1 |
| InChI | InChI=1S/C29H35N5O4/c1-36-26-19-23(9-12-25(26)38-18-15-34-13-16-37-17-14-34)27(29(35)32-20-21-5-3-2-4-6-21)33-24-10-7-22(8-11-24)28(30)31/h2-12,19,27,33H,13-18,20H2,1H3,(H3,30,31)(H,32,35)/t27-/m1/s1 |
| InChIKey | RODOXYBIBQMRBC-HHHXNRCGSA-N |
| XLogP | 3.16 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|