C30H31ClN4O3 — CID 70003228
(2R)-N-benzhydryl-2-(4-carbamimidoylanilino)-2-(3,4-dimethoxyphenyl)acetamide;hydrochloride (PubChem CID 70003228) has the molecular formula C30H31ClN4O3 and a molecular weight of 531.06 g/mol. Its IUPAC name is (2R)-N-benzhydryl-2-(4-carbamimidoylanilino)-2-(3,4-dimethoxyphenyl)acetamide;hydrochloride.
| Compound Name | (2R)-N-benzhydryl-2-(4-carbamimidoylanilino)-2-(3,4-dimethoxyphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 70003228 |
| Molecular Formula | C30H31ClN4O3 |
| Molecular Weight | 531.06 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | (2R)-N-benzhydryl-2-(4-carbamimidoylanilino)-2-(3,4-dimethoxyphenyl)acetamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(N[C@@H](C(=O)NC(c2ccccc2)c2ccccc2)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C30H30N4O3.ClH/c1-36-25-18-15-23(19-26(25)37-2)28(33-24-16-13-22(14-17-24)29(31)32)30(35)34-27(20-9-5-3-6-10-20)21-11-7-4-8-12-21;/h3-19,27-28,33H,1-2H3,(H3,31,32)(H,34,35);1H/t28-;/m1./s1 |
| InChIKey | WABYICYYGMKVEN-LNLSOMNWSA-N |
| XLogP | 5.47 |
| TPSA | 109.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.06 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|