C34H37N5O7 — CID 70280187
acetic acid;(2S)-3-(4-aminophenyl)-2-[[(2S)-2-(4-carbamimidoylanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]propanoic acid (PubChem CID 70280187) has the molecular formula C34H37N5O7 and a molecular weight of 627.70 g/mol. Its IUPAC name is acetic acid;(2S)-3-(4-aminophenyl)-2-[[(2S)-2-(4-carbamimidoylanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]propanoic acid.
| Compound Name | acetic acid;(2S)-3-(4-aminophenyl)-2-[[(2S)-2-(4-carbamimidoylanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70280187 |
| Molecular Formula | C34H37N5O7 |
| Molecular Weight | 627.70 g/mol |
| Exact Mass | 627.27 |
| IUPAC Name | acetic acid;(2S)-3-(4-aminophenyl)-2-[[(2S)-2-(4-carbamimidoylanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]propanoic acid |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(N[C@H](C(=O)N[C@@H](Cc2ccc(N)cc2)C(=O)O)c2ccc(OCc3ccccc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C32H33N5O5.C2H4O2/c1-41-28-18-23(11-16-27(28)42-19-21-5-3-2-4-6-21)29(36-25-14-9-22(10-15-25)30(34)35)31(38)37-26(32(39)40)17-20-7-12-24(33)13-8-20;1-2(3)4/h2-16,18,26,29,36H,17,19,33H2,1H3,(H3,34,35)(H,37,38)(H,39,40);1H3,(H,3,4)/t26-,29-;/m0./s1 |
| InChIKey | CTZWPLDAEASPOE-IMMIMJPRSA-N |
| XLogP | 4.20 |
| TPSA | 210.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.70 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|