C32H32N4O6 — CID 54457858
(2S)-2-[[(2S)-2-[4-(N'-hydroxycarbamimidoyl)anilino]-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]-3-phenylpropanoic acid (PubChem CID 54457858) has the molecular formula C32H32N4O6 and a molecular weight of 568.63 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[4-(N'-hydroxycarbamimidoyl)anilino]-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[4-(N'-hydroxycarbamimidoyl)anilino]-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 54457858 |
| Molecular Formula | C32H32N4O6 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | (2S)-2-[[(2S)-2-[4-(N'-hydroxycarbamimidoyl)anilino]-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]-3-phenylpropanoic acid |
| SMILES | COc1cc([C@H](Nc2ccc(C(N)=NO)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C32H32N4O6/c1-41-28-19-24(14-17-27(28)42-20-22-10-6-3-7-11-22)29(34-25-15-12-23(13-16-25)30(33)36-40)31(37)35-26(32(38)39)18-21-8-4-2-5-9-21/h2-17,19,26,29,34,40H,18,20H2,1H3,(H2,33,36)(H,35,37)(H,38,39)/t26-,29-/m0/s1 |
| InChIKey | WZMJKTUYQDKZKN-WNJJXGMVSA-N |
| XLogP | 4.33 |
| TPSA | 155.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|