C24H25N3O5 — CID 22039038
2-(3-ethoxy-4-phenylmethoxyphenyl)-2-[4-[(E)-N'-hydroxycarbamimidoyl]anilino]acetic acid (PubChem CID 22039038) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is 2-(3-ethoxy-4-phenylmethoxyphenyl)-2-[4-[(E)-N'-hydroxycarbamimidoyl]anilino]acetic acid.
| Compound Name | 2-(3-ethoxy-4-phenylmethoxyphenyl)-2-[4-[(E)-N'-hydroxycarbamimidoyl]anilino]acetic acid |
|---|---|
| PubChem CID | 22039038 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 2-(3-ethoxy-4-phenylmethoxyphenyl)-2-[4-[(E)-N'-hydroxycarbamimidoyl]anilino]acetic acid |
| SMILES | CCOc1cc(C(Nc2ccc(/C(N)=N\O)cc2)C(=O)O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H25N3O5/c1-2-31-21-14-18(10-13-20(21)32-15-16-6-4-3-5-7-16)22(24(28)29)26-19-11-8-17(9-12-19)23(25)27-30/h3-14,22,26,30H,2,15H2,1H3,(H2,25,27)(H,28,29) |
| InChIKey | NEDNOBYREJGLMO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|