C21H27N3O7 — CID 22039190
2-[4,5-diethoxy-2-(2-hydroxyethoxy)phenyl]-2-[4-[(Z)-N'-hydroxycarbamimidoyl]anilino]acetic acid (PubChem CID 22039190) has the molecular formula C21H27N3O7 and a molecular weight of 433.46 g/mol. Its IUPAC name is 2-[4,5-diethoxy-2-(2-hydroxyethoxy)phenyl]-2-[4-[(Z)-N'-hydroxycarbamimidoyl]anilino]acetic acid.
| Compound Name | 2-[4,5-diethoxy-2-(2-hydroxyethoxy)phenyl]-2-[4-[(Z)-N'-hydroxycarbamimidoyl]anilino]acetic acid |
|---|---|
| PubChem CID | 22039190 |
| Molecular Formula | C21H27N3O7 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 2-[4,5-diethoxy-2-(2-hydroxyethoxy)phenyl]-2-[4-[(Z)-N'-hydroxycarbamimidoyl]anilino]acetic acid |
| SMILES | CCOc1cc(OCCO)c(C(Nc2ccc(/C(N)=N/O)cc2)C(=O)O)cc1OCC |
| InChI | InChI=1S/C21H27N3O7/c1-3-29-17-11-15(16(31-10-9-25)12-18(17)30-4-2)19(21(26)27)23-14-7-5-13(6-8-14)20(22)24-28/h5-8,11-12,19,23,25,28H,3-4,9-10H2,1-2H3,(H2,22,24)(H,26,27) |
| InChIKey | OLHBHSRVQRTBIB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 155.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|