C21H26FN3O6 — CID 90917210
ethyl (2S)-2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetate (PubChem CID 90917210) has the molecular formula C21H26FN3O6 and a molecular weight of 435.45 g/mol. Its IUPAC name is ethyl (2S)-2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetate.
| Compound Name | ethyl (2S)-2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetate |
|---|---|
| PubChem CID | 90917210 |
| Molecular Formula | C21H26FN3O6 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | ethyl (2S)-2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetate |
| SMILES | CCOC(=O)[C@@H](Nc1ccc(C(N)=NO)cc1)c1cc(OCC)c(OCCO)cc1F |
| InChI | InChI=1S/C21H26FN3O6/c1-3-29-17-11-15(16(22)12-18(17)31-10-9-26)19(21(27)30-4-2)24-14-7-5-13(6-8-14)20(23)25-28/h5-8,11-12,19,24,26,28H,3-4,9-10H2,1-2H3,(H2,23,25)/t19-/m0/s1 |
| InChIKey | AWHKSYNTYWNWAP-IBGZPJMESA-N |
| XLogP | 2.41 |
| TPSA | 135.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|