C26H25FN2O5 — CID 70004559
benzyl 2-(4-cyanoanilino)-2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]acetate (PubChem CID 70004559) has the molecular formula C26H25FN2O5 and a molecular weight of 464.49 g/mol. Its IUPAC name is benzyl 2-(4-cyanoanilino)-2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]acetate.
| Compound Name | benzyl 2-(4-cyanoanilino)-2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 70004559 |
| Molecular Formula | C26H25FN2O5 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | benzyl 2-(4-cyanoanilino)-2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]acetate |
| SMILES | CCOc1cc(C(Nc2ccc(C#N)cc2)C(=O)OCc2ccccc2)c(F)cc1OCCO |
| InChI | InChI=1S/C26H25FN2O5/c1-2-32-23-14-21(22(27)15-24(23)33-13-12-30)25(29-20-10-8-18(16-28)9-11-20)26(31)34-17-19-6-4-3-5-7-19/h3-11,14-15,25,29-30H,2,12-13,17H2,1H3 |
| InChIKey | NGIAYTCLPXOERV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |