C31H29N3O4 — CID 70003619
(2S)-N-benzyl-2-(4-cyanoanilino)-2-(4,5-dimethoxy-2-phenylmethoxyphenyl)acetamide (PubChem CID 70003619) has the molecular formula C31H29N3O4 and a molecular weight of 507.59 g/mol. Its IUPAC name is (2S)-N-benzyl-2-(4-cyanoanilino)-2-(4,5-dimethoxy-2-phenylmethoxyphenyl)acetamide.
| Compound Name | (2S)-N-benzyl-2-(4-cyanoanilino)-2-(4,5-dimethoxy-2-phenylmethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 70003619 |
| Molecular Formula | C31H29N3O4 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | (2S)-N-benzyl-2-(4-cyanoanilino)-2-(4,5-dimethoxy-2-phenylmethoxyphenyl)acetamide |
| SMILES | COc1cc(OCc2ccccc2)c([C@H](Nc2ccc(C#N)cc2)C(=O)NCc2ccccc2)cc1OC |
| InChI | InChI=1S/C31H29N3O4/c1-36-28-17-26(27(18-29(28)37-2)38-21-24-11-7-4-8-12-24)30(34-25-15-13-22(19-32)14-16-25)31(35)33-20-23-9-5-3-6-10-23/h3-18,30,34H,20-21H2,1-2H3,(H,33,35)/t30-/m0/s1 |
| InChIKey | RJLFHGHHTUVYID-PMERELPUSA-N |
| XLogP | 5.62 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |