C36H31N3O4 — CID 23283646
N-benzyl-2-(4-cyanoanilino)-2-[3-methoxy-4-[(3-phenoxyphenyl)methoxy]phenyl]acetamide (PubChem CID 23283646) has the molecular formula C36H31N3O4 and a molecular weight of 569.66 g/mol. Its IUPAC name is N-benzyl-2-(4-cyanoanilino)-2-[3-methoxy-4-[(3-phenoxyphenyl)methoxy]phenyl]acetamide.
| Compound Name | N-benzyl-2-(4-cyanoanilino)-2-[3-methoxy-4-[(3-phenoxyphenyl)methoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 23283646 |
| Molecular Formula | C36H31N3O4 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | N-benzyl-2-(4-cyanoanilino)-2-[3-methoxy-4-[(3-phenoxyphenyl)methoxy]phenyl]acetamide |
| SMILES | COc1cc(C(Nc2ccc(C#N)cc2)C(=O)NCc2ccccc2)ccc1OCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C36H31N3O4/c1-41-34-22-29(17-20-33(34)42-25-28-11-8-14-32(21-28)43-31-12-6-3-7-13-31)35(39-30-18-15-26(23-37)16-19-30)36(40)38-24-27-9-4-2-5-10-27/h2-22,35,39H,24-25H2,1H3,(H,38,40) |
| InChIKey | SIHOTDRPFWDLED-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |