C28H29N3O6 — CID 23283390
4-[2-[2-(benzylamino)-1-(4-cyanoanilino)-2-oxoethyl]-4,5-dimethoxyphenoxy]butanoic acid (PubChem CID 23283390) has the molecular formula C28H29N3O6 and a molecular weight of 503.56 g/mol. Its IUPAC name is 4-[2-[2-(benzylamino)-1-(4-cyanoanilino)-2-oxoethyl]-4,5-dimethoxyphenoxy]butanoic acid.
| Compound Name | 4-[2-[2-(benzylamino)-1-(4-cyanoanilino)-2-oxoethyl]-4,5-dimethoxyphenoxy]butanoic acid |
|---|---|
| PubChem CID | 23283390 |
| Molecular Formula | C28H29N3O6 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 4-[2-[2-(benzylamino)-1-(4-cyanoanilino)-2-oxoethyl]-4,5-dimethoxyphenoxy]butanoic acid |
| SMILES | COc1cc(OCCCC(=O)O)c(C(Nc2ccc(C#N)cc2)C(=O)NCc2ccccc2)cc1OC |
| InChI | InChI=1S/C28H29N3O6/c1-35-24-15-22(23(16-25(24)36-2)37-14-6-9-26(32)33)27(31-21-12-10-19(17-29)11-13-21)28(34)30-18-20-7-4-3-5-8-20/h3-5,7-8,10-13,15-16,27,31H,6,9,14,18H2,1-2H3,(H,30,34)(H,32,33) |
| InChIKey | HAYILXWNOMJEHU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 129.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|