C31H31N5O6 — CID 74032492
[2-[2-(benzylamino)-1-[4-(N'-hydroxycarbamimidoyl)anilino]-2-oxoethyl]-4-methoxy-5-phenylmethoxyphenyl]carbamic acid (PubChem CID 74032492) has the molecular formula C31H31N5O6 and a molecular weight of 569.62 g/mol. Its IUPAC name is [2-[2-(benzylamino)-1-[4-(N'-hydroxycarbamimidoyl)anilino]-2-oxoethyl]-4-methoxy-5-phenylmethoxyphenyl]carbamic acid.
| Compound Name | [2-[2-(benzylamino)-1-[4-(N'-hydroxycarbamimidoyl)anilino]-2-oxoethyl]-4-methoxy-5-phenylmethoxyphenyl]carbamic acid |
|---|---|
| PubChem CID | 74032492 |
| Molecular Formula | C31H31N5O6 |
| Molecular Weight | 569.62 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | [2-[2-(benzylamino)-1-[4-(N'-hydroxycarbamimidoyl)anilino]-2-oxoethyl]-4-methoxy-5-phenylmethoxyphenyl]carbamic acid |
| SMILES | COc1cc(C(Nc2ccc(C(N)=NO)cc2)C(=O)NCc2ccccc2)c(NC(=O)O)cc1OCc1ccccc1 |
| InChI | InChI=1S/C31H31N5O6/c1-41-26-16-24(25(35-31(38)39)17-27(26)42-19-21-10-6-3-7-11-21)28(30(37)33-18-20-8-4-2-5-9-20)34-23-14-12-22(13-15-23)29(32)36-40/h2-17,28,34-35,40H,18-19H2,1H3,(H2,32,36)(H,33,37)(H,38,39) |
| InChIKey | DIIDCGQTQHBAOZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 167.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|