C38H37N5O5 — CID 142634628
2-[N-benzyl-4-[(Z)-N'-hydroxycarbamimidoyl]anilino]-2-[5-methoxy-2-[(2-phenylacetyl)amino]-4-phenylmethoxyphenyl]acetamide (PubChem CID 142634628) has the molecular formula C38H37N5O5 and a molecular weight of 643.74 g/mol. Its IUPAC name is 2-[N-benzyl-4-[(Z)-N'-hydroxycarbamimidoyl]anilino]-2-[5-methoxy-2-[(2-phenylacetyl)amino]-4-phenylmethoxyphenyl]acetamide.
| Compound Name | 2-[N-benzyl-4-[(Z)-N'-hydroxycarbamimidoyl]anilino]-2-[5-methoxy-2-[(2-phenylacetyl)amino]-4-phenylmethoxyphenyl]acetamide |
|---|---|
| PubChem CID | 142634628 |
| Molecular Formula | C38H37N5O5 |
| Molecular Weight | 643.74 g/mol |
| Exact Mass | 643.28 |
| IUPAC Name | 2-[N-benzyl-4-[(Z)-N'-hydroxycarbamimidoyl]anilino]-2-[5-methoxy-2-[(2-phenylacetyl)amino]-4-phenylmethoxyphenyl]acetamide |
| SMILES | COc1cc(C(C(N)=O)N(Cc2ccccc2)c2ccc(/C(N)=N/O)cc2)c(NC(=O)Cc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C38H37N5O5/c1-47-33-22-31(32(41-35(44)21-26-11-5-2-6-12-26)23-34(33)48-25-28-15-9-4-10-16-28)36(38(40)45)43(24-27-13-7-3-8-14-27)30-19-17-29(18-20-30)37(39)42-46/h2-20,22-23,36,46H,21,24-25H2,1H3,(H2,39,42)(H2,40,45)(H,41,44) |
| InChIKey | LTDCTVHPLXIANQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 152.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.74 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|