C29H29N5O5S — CID 54024445
2-[2-(benzenesulfonamido)-5-methoxyphenyl]-N-benzyl-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetamide (PubChem CID 54024445) has the molecular formula C29H29N5O5S and a molecular weight of 559.65 g/mol. Its IUPAC name is 2-[2-(benzenesulfonamido)-5-methoxyphenyl]-N-benzyl-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetamide.
| Compound Name | 2-[2-(benzenesulfonamido)-5-methoxyphenyl]-N-benzyl-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetamide |
|---|---|
| PubChem CID | 54024445 |
| Molecular Formula | C29H29N5O5S |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | 2-[2-(benzenesulfonamido)-5-methoxyphenyl]-N-benzyl-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccccc2)c(C(Nc2ccc(C(N)=NO)cc2)C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C29H29N5O5S/c1-39-23-16-17-26(34-40(37,38)24-10-6-3-7-11-24)25(18-23)27(29(35)31-19-20-8-4-2-5-9-20)32-22-14-12-21(13-15-22)28(30)33-36/h2-18,27,32,34,36H,19H2,1H3,(H2,30,33)(H,31,35) |
| InChIKey | LBEUSQMUGUUPCQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|