C23H25ClN4O3 — CID 70280828
(2S)-N-benzyl-2-(4-carbamimidoylanilino)-2-(2-hydroxy-4-methoxyphenyl)acetamide;hydrochloride (PubChem CID 70280828) has the molecular formula C23H25ClN4O3 and a molecular weight of 440.93 g/mol. Its IUPAC name is (2S)-N-benzyl-2-(4-carbamimidoylanilino)-2-(2-hydroxy-4-methoxyphenyl)acetamide;hydrochloride.
| Compound Name | (2S)-N-benzyl-2-(4-carbamimidoylanilino)-2-(2-hydroxy-4-methoxyphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 70280828 |
| Molecular Formula | C23H25ClN4O3 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (2S)-N-benzyl-2-(4-carbamimidoylanilino)-2-(2-hydroxy-4-methoxyphenyl)acetamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(N[C@H](C(=O)NCc2ccccc2)c2ccc(OC)cc2O)cc1 |
| InChI | InChI=1S/C23H24N4O3.ClH/c1-30-18-11-12-19(20(28)13-18)21(23(29)26-14-15-5-3-2-4-6-15)27-17-9-7-16(8-10-17)22(24)25;/h2-13,21,27-28H,14H2,1H3,(H3,24,25)(H,26,29);1H/t21-;/m0./s1 |
| InChIKey | HOWZUCMOHQTARI-BOXHHOBZSA-N |
| XLogP | 3.58 |
| TPSA | 120.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|