C30H29N5O6 — CID 23283259
N-benzyl-2-[4-[(E)-N'-hydroxycarbamimidoyl]anilino]-2-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]acetamide (PubChem CID 23283259) has the molecular formula C30H29N5O6 and a molecular weight of 555.59 g/mol. Its IUPAC name is N-benzyl-2-[4-[(E)-N'-hydroxycarbamimidoyl]anilino]-2-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]acetamide.
| Compound Name | N-benzyl-2-[4-[(E)-N'-hydroxycarbamimidoyl]anilino]-2-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 23283259 |
| Molecular Formula | C30H29N5O6 |
| Molecular Weight | 555.59 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | N-benzyl-2-[4-[(E)-N'-hydroxycarbamimidoyl]anilino]-2-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]acetamide |
| SMILES | COc1cc(C(Nc2ccc(/C(N)=N\O)cc2)C(=O)NCc2ccccc2)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H29N5O6/c1-40-27-17-23(11-16-26(27)41-19-21-7-14-25(15-8-21)35(38)39)28(30(36)32-18-20-5-3-2-4-6-20)33-24-12-9-22(10-13-24)29(31)34-37/h2-17,28,33,37H,18-19H2,1H3,(H2,31,34)(H,32,36) |
| InChIKey | WPIHMHNKFRERKB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|