C31H33N5O6S — CID 173241448
(2S)-2-[4-(N'-hydroxycarbamimidoyl)anilino]-2-(3-methoxy-4-phenylmethoxyphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 173241448) has the molecular formula C31H33N5O6S and a molecular weight of 603.70 g/mol. Its IUPAC name is (2S)-2-[4-(N'-hydroxycarbamimidoyl)anilino]-2-(3-methoxy-4-phenylmethoxyphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | (2S)-2-[4-(N'-hydroxycarbamimidoyl)anilino]-2-(3-methoxy-4-phenylmethoxyphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 173241448 |
| Molecular Formula | C31H33N5O6S |
| Molecular Weight | 603.70 g/mol |
| Exact Mass | 603.22 |
| IUPAC Name | (2S)-2-[4-(N'-hydroxycarbamimidoyl)anilino]-2-(3-methoxy-4-phenylmethoxyphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | COc1cc([C@H](Nc2ccc(C(N)=NO)cc2)C(=O)NCCc2ccc(S(N)(=O)=O)cc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C31H33N5O6S/c1-41-28-19-24(11-16-27(28)42-20-22-5-3-2-4-6-22)29(35-25-12-9-23(10-13-25)30(32)36-38)31(37)34-18-17-21-7-14-26(15-8-21)43(33,39)40/h2-16,19,29,35,38H,17-18,20H2,1H3,(H2,32,36)(H,34,37)(H2,33,39,40)/t29-/m0/s1 |
| InChIKey | HIGFTPLYFXTQOL-LJAQVGFWSA-N |
| XLogP | 3.53 |
| TPSA | 178.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.70 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|