C33H34N4O5 — CID 70281861
[(2S)-2-[[(2R)-2-(4-carbamimidoylanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]-2-phenylethyl] acetate (PubChem CID 70281861) has the molecular formula C33H34N4O5 and a molecular weight of 566.66 g/mol. Its IUPAC name is [(2S)-2-[[(2R)-2-(4-carbamimidoylanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]-2-phenylethyl] acetate.
| Compound Name | [(2S)-2-[[(2R)-2-(4-carbamimidoylanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]-2-phenylethyl] acetate |
|---|---|
| PubChem CID | 70281861 |
| Molecular Formula | C33H34N4O5 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | [(2S)-2-[[(2R)-2-(4-carbamimidoylanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]-2-phenylethyl] acetate |
| SMILES | [H]/N=C(\N)c1ccc(N[C@@H](C(=O)N[C@H](COC(C)=O)c2ccccc2)c2ccc(OCc3ccccc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C33H34N4O5/c1-22(38)41-21-28(24-11-7-4-8-12-24)37-33(39)31(36-27-16-13-25(14-17-27)32(34)35)26-15-18-29(30(19-26)40-2)42-20-23-9-5-3-6-10-23/h3-19,28,31,36H,20-21H2,1-2H3,(H3,34,35)(H,37,39)/t28-,31-/m1/s1 |
| InChIKey | FQXBQESNAHSWDV-GRKNLSHJSA-N |
| XLogP | 5.13 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|