C32H39N5O7 — CID 142634637
(2S)-2-amino-2-[[(2R)-2-(4-carbamimidoylanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (PubChem CID 142634637) has the molecular formula C32H39N5O7 and a molecular weight of 605.69 g/mol. Its IUPAC name is (2S)-2-amino-2-[[(2R)-2-(4-carbamimidoylanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-2-[[(2R)-2-(4-carbamimidoylanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 142634637 |
| Molecular Formula | C32H39N5O7 |
| Molecular Weight | 605.69 g/mol |
| Exact Mass | 605.28 |
| IUPAC Name | (2S)-2-amino-2-[[(2R)-2-(4-carbamimidoylanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(N[C@@H](C(=O)N[C@@](N)(CCC(=O)OC(C)(C)C)C(=O)O)c2ccc(OCc3ccccc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C32H39N5O7/c1-31(2,3)44-26(38)16-17-32(35,30(40)41)37-29(39)27(36-23-13-10-21(11-14-23)28(33)34)22-12-15-24(25(18-22)42-4)43-19-20-8-6-5-7-9-20/h5-15,18,27,36H,16-17,19,35H2,1-4H3,(H3,33,34)(H,37,39)(H,40,41)/t27-,32+/m1/s1 |
| InChIKey | XZYDNWKPZZKREX-ZUKKLESISA-N |
| XLogP | 3.69 |
| TPSA | 199.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.69 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|