C33H36N4O5 — CID 70282213
acetic acid;(2R)-2-(4-carbamimidoylanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)-N-(2-phenylethyl)acetamide (PubChem CID 70282213) has the molecular formula C33H36N4O5 and a molecular weight of 568.67 g/mol. Its IUPAC name is acetic acid;(2R)-2-(4-carbamimidoylanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)-N-(2-phenylethyl)acetamide.
| Compound Name | acetic acid;(2R)-2-(4-carbamimidoylanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 70282213 |
| Molecular Formula | C33H36N4O5 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | acetic acid;(2R)-2-(4-carbamimidoylanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)-N-(2-phenylethyl)acetamide |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(N[C@@H](C(=O)NCCc2ccccc2)c2ccc(OCc3ccccc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C31H32N4O3.C2H4O2/c1-37-28-20-25(14-17-27(28)38-21-23-10-6-3-7-11-23)29(35-26-15-12-24(13-16-26)30(32)33)31(36)34-19-18-22-8-4-2-5-9-22;1-2(3)4/h2-17,20,29,35H,18-19,21H2,1H3,(H3,32,33)(H,34,36);1H3,(H,3,4)/t29-;/m1./s1 |
| InChIKey | MMCWDTMGVQTMDV-XXIQNXCHSA-N |
| XLogP | 5.16 |
| TPSA | 146.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|