C33H28N4O3 — CID 70004084
(2S)-N-benzyl-2-(4-cyanoanilino)-2-[3-methoxy-4-(quinolin-7-ylmethoxy)phenyl]acetamide (PubChem CID 70004084) has the molecular formula C33H28N4O3 and a molecular weight of 528.61 g/mol. Its IUPAC name is (2S)-N-benzyl-2-(4-cyanoanilino)-2-[3-methoxy-4-(quinolin-7-ylmethoxy)phenyl]acetamide.
| Compound Name | (2S)-N-benzyl-2-(4-cyanoanilino)-2-[3-methoxy-4-(quinolin-7-ylmethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 70004084 |
| Molecular Formula | C33H28N4O3 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | (2S)-N-benzyl-2-(4-cyanoanilino)-2-[3-methoxy-4-(quinolin-7-ylmethoxy)phenyl]acetamide |
| SMILES | COc1cc([C@H](Nc2ccc(C#N)cc2)C(=O)NCc2ccccc2)ccc1OCc1ccc2cccnc2c1 |
| InChI | InChI=1S/C33H28N4O3/c1-39-31-19-27(13-16-30(31)40-22-25-9-12-26-8-5-17-35-29(26)18-25)32(37-28-14-10-23(20-34)11-15-28)33(38)36-21-24-6-3-2-4-7-24/h2-19,32,37H,21-22H2,1H3,(H,36,38)/t32-/m0/s1 |
| InChIKey | BVWVAOFRDUTBKW-YTTGMZPUSA-N |
| XLogP | 6.16 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |