C30H25N3O5 — CID 23283388
3-[[2-(4-cyanoanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]benzoic acid (PubChem CID 23283388) has the molecular formula C30H25N3O5 and a molecular weight of 507.55 g/mol. Its IUPAC name is 3-[[2-(4-cyanoanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]benzoic acid.
| Compound Name | 3-[[2-(4-cyanoanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 23283388 |
| Molecular Formula | C30H25N3O5 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 3-[[2-(4-cyanoanilino)-2-(3-methoxy-4-phenylmethoxyphenyl)acetyl]amino]benzoic acid |
| SMILES | COc1cc(C(Nc2ccc(C#N)cc2)C(=O)Nc2cccc(C(=O)O)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C30H25N3O5/c1-37-27-17-22(12-15-26(27)38-19-21-6-3-2-4-7-21)28(32-24-13-10-20(18-31)11-14-24)29(34)33-25-9-5-8-23(16-25)30(35)36/h2-17,28,32H,19H2,1H3,(H,33,34)(H,35,36) |
| InChIKey | FQWDBQFBEYUOGK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |