C17H15N2O4- — CID 22040045
2-(4-cyanoanilino)-2-(3,4-dimethoxyphenyl)acetate (PubChem CID 22040045) has the molecular formula C17H15N2O4- and a molecular weight of 311.32 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-2-(3,4-dimethoxyphenyl)acetate.
| Compound Name | 2-(4-cyanoanilino)-2-(3,4-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 22040045 |
| Molecular Formula | C17H15N2O4- |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2-(4-cyanoanilino)-2-(3,4-dimethoxyphenyl)acetate |
| SMILES | COc1ccc(C(Nc2ccc(C#N)cc2)C(=O)[O-])cc1OC |
| InChI | InChI=1S/C17H16N2O4/c1-22-14-8-5-12(9-15(14)23-2)16(17(20)21)19-13-6-3-11(10-18)4-7-13/h3-9,16,19H,1-2H3,(H,20,21)/p-1 |
| InChIKey | BNAXTVOKFOKDQK-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 94.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |