C17H16N3O3- — CID 22039322
2-(4-amino-3-ethoxyphenyl)-2-(4-cyanoanilino)acetate (PubChem CID 22039322) has the molecular formula C17H16N3O3- and a molecular weight of 310.33 g/mol. Its IUPAC name is 2-(4-amino-3-ethoxyphenyl)-2-(4-cyanoanilino)acetate.
| Compound Name | 2-(4-amino-3-ethoxyphenyl)-2-(4-cyanoanilino)acetate |
|---|---|
| PubChem CID | 22039322 |
| Molecular Formula | C17H16N3O3- |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-(4-amino-3-ethoxyphenyl)-2-(4-cyanoanilino)acetate |
| SMILES | CCOc1cc(C(Nc2ccc(C#N)cc2)C(=O)[O-])ccc1N |
| InChI | InChI=1S/C17H17N3O3/c1-2-23-15-9-12(5-8-14(15)19)16(17(21)22)20-13-6-3-11(10-18)4-7-13/h3-9,16,20H,2,19H2,1H3,(H,21,22)/p-1 |
| InChIKey | SOVZJQVRTXXHIJ-UHFFFAOYSA-M |
| XLogP | 1.44 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|