C21H22N2O6 — CID 22040000
2-(4-cyanoanilino)-2-[3-ethoxy-5-(2-ethoxy-2-oxoethoxy)phenyl]acetic acid (PubChem CID 22040000) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-2-[3-ethoxy-5-(2-ethoxy-2-oxoethoxy)phenyl]acetic acid.
| Compound Name | 2-(4-cyanoanilino)-2-[3-ethoxy-5-(2-ethoxy-2-oxoethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 22040000 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-(4-cyanoanilino)-2-[3-ethoxy-5-(2-ethoxy-2-oxoethoxy)phenyl]acetic acid |
| SMILES | CCOC(=O)COc1cc(OCC)cc(C(Nc2ccc(C#N)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C21H22N2O6/c1-3-27-17-9-15(10-18(11-17)29-13-19(24)28-4-2)20(21(25)26)23-16-7-5-14(12-22)6-8-16/h5-11,20,23H,3-4,13H2,1-2H3,(H,25,26) |
| InChIKey | SJRXMYGTWVPKFK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |