C27H27FN2O4 — CID 139927855
ethyl 2-(4-cyanoanilino)-2-[3-ethoxy-5-[2-(4-fluorophenyl)ethoxy]phenyl]acetate (PubChem CID 139927855) has the molecular formula C27H27FN2O4 and a molecular weight of 462.52 g/mol. Its IUPAC name is ethyl 2-(4-cyanoanilino)-2-[3-ethoxy-5-[2-(4-fluorophenyl)ethoxy]phenyl]acetate.
| Compound Name | ethyl 2-(4-cyanoanilino)-2-[3-ethoxy-5-[2-(4-fluorophenyl)ethoxy]phenyl]acetate |
|---|---|
| PubChem CID | 139927855 |
| Molecular Formula | C27H27FN2O4 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | ethyl 2-(4-cyanoanilino)-2-[3-ethoxy-5-[2-(4-fluorophenyl)ethoxy]phenyl]acetate |
| SMILES | CCOC(=O)C(Nc1ccc(C#N)cc1)c1cc(OCC)cc(OCCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C27H27FN2O4/c1-3-32-24-15-21(16-25(17-24)34-14-13-19-5-9-22(28)10-6-19)26(27(31)33-4-2)30-23-11-7-20(18-29)8-12-23/h5-12,15-17,26,30H,3-4,13-14H2,1-2H3 |
| InChIKey | SDYCRKKHUDVHPC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |