C22H24N3O3- — CID 22039618
2-(4-cyanoanilino)-2-[3-ethoxy-5-(pyrrolidin-1-ylmethyl)phenyl]acetate (PubChem CID 22039618) has the molecular formula C22H24N3O3- and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-2-[3-ethoxy-5-(pyrrolidin-1-ylmethyl)phenyl]acetate.
| Compound Name | 2-(4-cyanoanilino)-2-[3-ethoxy-5-(pyrrolidin-1-ylmethyl)phenyl]acetate |
|---|---|
| PubChem CID | 22039618 |
| Molecular Formula | C22H24N3O3- |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-(4-cyanoanilino)-2-[3-ethoxy-5-(pyrrolidin-1-ylmethyl)phenyl]acetate |
| SMILES | CCOc1cc(CN2CCCC2)cc(C(Nc2ccc(C#N)cc2)C(=O)[O-])c1 |
| InChI | InChI=1S/C22H25N3O3/c1-2-28-20-12-17(15-25-9-3-4-10-25)11-18(13-20)21(22(26)27)24-19-7-5-16(14-23)6-8-19/h5-8,11-13,21,24H,2-4,9-10,15H2,1H3,(H,26,27)/p-1 |
| InChIKey | FZFQYHDSSZRGAO-UHFFFAOYSA-M |
| XLogP | 2.46 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |