C23H19N2O3- — CID 22039629
2-(4-cyanoanilino)-2-(3-ethyl-5-phenoxyphenyl)acetate (PubChem CID 22039629) has the molecular formula C23H19N2O3- and a molecular weight of 371.42 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-2-(3-ethyl-5-phenoxyphenyl)acetate.
| Compound Name | 2-(4-cyanoanilino)-2-(3-ethyl-5-phenoxyphenyl)acetate |
|---|---|
| PubChem CID | 22039629 |
| Molecular Formula | C23H19N2O3- |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-(4-cyanoanilino)-2-(3-ethyl-5-phenoxyphenyl)acetate |
| SMILES | CCc1cc(Oc2ccccc2)cc(C(Nc2ccc(C#N)cc2)C(=O)[O-])c1 |
| InChI | InChI=1S/C23H20N2O3/c1-2-16-12-18(14-21(13-16)28-20-6-4-3-5-7-20)22(23(26)27)25-19-10-8-17(15-24)9-11-19/h3-14,22,25H,2H2,1H3,(H,26,27)/p-1 |
| InChIKey | IAGKLVKUXRMNDO-UHFFFAOYSA-M |
| XLogP | 3.82 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |