C17H15N2O3S- — CID 22038934
2-(4-cyanoanilino)-2-(3-ethylsulfanyl-4-hydroxyphenyl)acetate (PubChem CID 22038934) has the molecular formula C17H15N2O3S- and a molecular weight of 327.39 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-2-(3-ethylsulfanyl-4-hydroxyphenyl)acetate.
| Compound Name | 2-(4-cyanoanilino)-2-(3-ethylsulfanyl-4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 22038934 |
| Molecular Formula | C17H15N2O3S- |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-(4-cyanoanilino)-2-(3-ethylsulfanyl-4-hydroxyphenyl)acetate |
| SMILES | CCSc1cc(C(Nc2ccc(C#N)cc2)C(=O)[O-])ccc1O |
| InChI | InChI=1S/C17H16N2O3S/c1-2-23-15-9-12(5-8-14(15)20)16(17(21)22)19-13-6-3-11(10-18)4-7-13/h3-9,16,19-20H,2H2,1H3,(H,21,22)/p-1 |
| InChIKey | RRBFYLWIODVXBQ-UHFFFAOYSA-M |
| XLogP | 2.28 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |