C22H18N3O2- — CID 22039840
2-[3-(3-aminophenyl)-5-methylphenyl]-2-(4-cyanoanilino)acetate (PubChem CID 22039840) has the molecular formula C22H18N3O2- and a molecular weight of 356.41 g/mol. Its IUPAC name is 2-[3-(3-aminophenyl)-5-methylphenyl]-2-(4-cyanoanilino)acetate.
| Compound Name | 2-[3-(3-aminophenyl)-5-methylphenyl]-2-(4-cyanoanilino)acetate |
|---|---|
| PubChem CID | 22039840 |
| Molecular Formula | C22H18N3O2- |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-[3-(3-aminophenyl)-5-methylphenyl]-2-(4-cyanoanilino)acetate |
| SMILES | Cc1cc(-c2cccc(N)c2)cc(C(Nc2ccc(C#N)cc2)C(=O)[O-])c1 |
| InChI | InChI=1S/C22H19N3O2/c1-14-9-17(16-3-2-4-19(24)12-16)11-18(10-14)21(22(26)27)25-20-7-5-15(13-23)6-8-20/h2-12,21,25H,24H2,1H3,(H,26,27)/p-1 |
| InChIKey | GUIPPFSTRCLZPJ-UHFFFAOYSA-M |
| XLogP | 3.02 |
| TPSA | 101.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|