C24H26ClN4O2- — CID 22040188
2-(4-carbamimidoylanilino)-2-[3-[3-(dimethylamino)phenyl]-5-methylphenyl]acetate;hydrochloride (PubChem CID 22040188) has the molecular formula C24H26ClN4O2- and a molecular weight of 437.95 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-[3-[3-(dimethylamino)phenyl]-5-methylphenyl]acetate;hydrochloride.
| Compound Name | 2-(4-carbamimidoylanilino)-2-[3-[3-(dimethylamino)phenyl]-5-methylphenyl]acetate;hydrochloride |
|---|---|
| PubChem CID | 22040188 |
| Molecular Formula | C24H26ClN4O2- |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-[3-[3-(dimethylamino)phenyl]-5-methylphenyl]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NC(C(=O)[O-])c2cc(C)cc(-c3cccc(N(C)C)c3)c2)cc1 |
| InChI | InChI=1S/C24H26N4O2.ClH/c1-15-11-18(17-5-4-6-21(14-17)28(2)3)13-19(12-15)22(24(29)30)27-20-9-7-16(8-10-20)23(25)26;/h4-14,22,27H,1-3H3,(H3,25,26)(H,29,30);1H/p-1 |
| InChIKey | WROSBPGRXVJFPF-UHFFFAOYSA-M |
| XLogP | 3.34 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|