C21H21ClN3O3S- — CID 22038736
2-(4-carbamimidoylanilino)-2-(3-ethoxy-5-thiophen-2-ylphenyl)acetate;hydrochloride (PubChem CID 22038736) has the molecular formula C21H21ClN3O3S- and a molecular weight of 430.94 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-(3-ethoxy-5-thiophen-2-ylphenyl)acetate;hydrochloride.
| Compound Name | 2-(4-carbamimidoylanilino)-2-(3-ethoxy-5-thiophen-2-ylphenyl)acetate;hydrochloride |
|---|---|
| PubChem CID | 22038736 |
| Molecular Formula | C21H21ClN3O3S- |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-(3-ethoxy-5-thiophen-2-ylphenyl)acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NC(C(=O)[O-])c2cc(OCC)cc(-c3cccs3)c2)cc1 |
| InChI | InChI=1S/C21H21N3O3S.ClH/c1-2-27-17-11-14(18-4-3-9-28-18)10-15(12-17)19(21(25)26)24-16-7-5-13(6-8-16)20(22)23;/h3-12,19,24H,2H2,1H3,(H3,22,23)(H,25,26);1H/p-1 |
| InChIKey | VSKCYAIUXHHCEE-UHFFFAOYSA-M |
| XLogP | 3.42 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|