C25H33N3O4 — CID 22039576
2-(4-carbamimidoylanilino)-2-[3-(2-cyclohexylethoxy)-5-ethoxyphenyl]acetic acid (PubChem CID 22039576) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-[3-(2-cyclohexylethoxy)-5-ethoxyphenyl]acetic acid.
| Compound Name | 2-(4-carbamimidoylanilino)-2-[3-(2-cyclohexylethoxy)-5-ethoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 22039576 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-[3-(2-cyclohexylethoxy)-5-ethoxyphenyl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)O)c2cc(OCC)cc(OCCC3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C25H33N3O4/c1-2-31-21-14-19(15-22(16-21)32-13-12-17-6-4-3-5-7-17)23(25(29)30)28-20-10-8-18(9-11-20)24(26)27/h8-11,14-17,23,28H,2-7,12-13H2,1H3,(H3,26,27)(H,29,30) |
| InChIKey | NPHLKBVRWDCLNX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 117.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|