C15H14Cl3N3O2 — CID 18407835
2-(4-carbamimidoylanilino)-2-(3,5-dichlorophenyl)acetic acid;hydrochloride (PubChem CID 18407835) has the molecular formula C15H14Cl3N3O2 and a molecular weight of 374.66 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-(3,5-dichlorophenyl)acetic acid;hydrochloride.
| Compound Name | 2-(4-carbamimidoylanilino)-2-(3,5-dichlorophenyl)acetic acid;hydrochloride |
|---|---|
| PubChem CID | 18407835 |
| Molecular Formula | C15H14Cl3N3O2 |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-(3,5-dichlorophenyl)acetic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NC(C(=O)O)c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C15H13Cl2N3O2.ClH/c16-10-5-9(6-11(17)7-10)13(15(21)22)20-12-3-1-8(2-4-12)14(18)19;/h1-7,13,20H,(H3,18,19)(H,21,22);1H |
| InChIKey | AIAISRFYBXNBIB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 99.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|