C25H27N3O5 — CID 57068252
(2R)-2-(4-carbamimidoylanilino)-2-[3-ethoxy-5-(2-phenoxyethoxy)phenyl]acetic acid (PubChem CID 57068252) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is (2R)-2-(4-carbamimidoylanilino)-2-[3-ethoxy-5-(2-phenoxyethoxy)phenyl]acetic acid.
| Compound Name | (2R)-2-(4-carbamimidoylanilino)-2-[3-ethoxy-5-(2-phenoxyethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 57068252 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | (2R)-2-(4-carbamimidoylanilino)-2-[3-ethoxy-5-(2-phenoxyethoxy)phenyl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(N[C@@H](C(=O)O)c2cc(OCC)cc(OCCOc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H27N3O5/c1-2-31-21-14-18(15-22(16-21)33-13-12-32-20-6-4-3-5-7-20)23(25(29)30)28-19-10-8-17(9-11-19)24(26)27/h3-11,14-16,23,28H,2,12-13H2,1H3,(H3,26,27)(H,29,30)/t23-/m1/s1 |
| InChIKey | CKXKRXWVUJGRHP-HSZRJFAPSA-N |
| XLogP | 4.06 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|